Update README.md
Browse files
    	
        README.md
    CHANGED
    
    | 
         @@ -22,6 +22,10 @@ It introduces a **new reinforcement learning framework** as the next iteration o 
     | 
|
| 22 | 
         | 
| 23 | 
         
             
            *Prototype research code — not production-ready. Built for speed, not scale.*
         
     | 
| 24 | 
         | 
| 
         | 
|
| 
         | 
|
| 
         | 
|
| 
         | 
|
| 25 | 
         
             
            
         
     | 
| 26 | 
         | 
| 27 | 
         
             
            ---
         
     | 
| 
         | 
|
| 22 | 
         | 
| 23 | 
         
             
            *Prototype research code — not production-ready. Built for speed, not scale.*
         
     | 
| 24 | 
         | 
| 25 | 
         
            +
            Example of generated molecule, found no identical mol in PubChem
         
     | 
| 26 | 
         
            +
             
     | 
| 27 | 
         
            +
            `O=C(O)CC=1CCCCC=1C2=CC=CC(=C2)NC(=O)CC3=CC=CC=C3CCC`
         
     | 
| 28 | 
         
            +
             
     | 
| 29 | 
         
             
            
         
     | 
| 30 | 
         | 
| 31 | 
         
             
            ---
         
     |