OpenMol/LPM-24_molgen_extra-SFT · Datasets at Hugging Face

instruction stringlengths 51 2.18k	output stringlengths 1 833	input stringclasses 1 value
Can you create a molecule that matches the given characteristics? The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease.	CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation that impacts both tangier disease and diabetic heart disease. The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a apoptosis.	CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and barth syndrome.	CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC
Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation that impacts both barth syndrome and tangier disease. The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure. The molecule is a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease.	CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation, stabilizing cytochrome oxidase. It impacts barth syndrome, tangier disease, non-alcoholic fatty liver disease, and aging.	CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. The molecule is both a apoptosis and a cholesterol translocation.	CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging.	CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C
Generate a molecule based on this description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and tangier disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.	CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome. Please write the SMILES representation of it.	CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and barth syndrome. The molecule is a apoptosis and a cholesterol translocation, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure that impacts aging.	CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C
Can you create a molecule that matches the given characteristics? It impacts both cardiovascular disease and pancreatitis. The molecule is a nutrient, fat storage, thyroxine treatment that impacts metabolic syndrome and atherosclerosis.	CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Generate a molecule that fulfills the requirement: The molecule is a fat storage that impacts pancreatitis. The molecule is a nutrient that impacts atherosclerosis, cardiovascular disease, metabolic syndrome, and thyroxine treatment.	CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Come up with a molecule based on the description: It impacts pancreatitis. The molecule is a nutrient and a fat storage, which impacts cardiovascular disease, metabolic syndrome, and atherosclerosis, and is characterized as thyroxine treatment.	CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Build a molecule that meets the requirement: The molecule is a nutrient and thyroxine treatment, impacting pancreatitis, metabolic syndrome, and atherosclerosis. The molecule is a fat storage that impacts cardiovascular disease.	CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a fat storage, nutrient, thyroxine treatment that impacts metabolic syndrome and cardiovascular disease. It impacts both pancreatitis and atherosclerosis.	CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Come up with a molecule based on the description: The molecule is a anti protozoal and is anti bacterial.	CC(C)(C)C(N)c1nc2ccccc2[nH]1
Can you create a molecule that matches the given characteristics? The molecule is a anti protozoal and is anti bacterial.	CC(C)(C)C(N)c1nc2ccccc2[nH]1
Build a molecule that meets the requirement: It belongs to both the anti protozoal and anti bacterial classes of molecules.	CC(C)(C)C(N)c1nc2ccccc2[nH]1
The molecule is a anti protozoal member of the anti bacterial class. Use the above information to create a molecule.	CC(C)(C)C(N)c1nc2ccccc2[nH]1
Suppose there is a molecule that meets the following description: The molecule is a anti protozoal member of the anti bacterial class. Please write the SMILES representation of it.	CC(C)(C)C(N)c1nc2ccccc2[nH]1
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a 5ht2c receptor agonist.	O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2
The molecule is a 5ht2c receptor agonist. Use the above information to create a molecule.	O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a 5ht2c receptor agonist.	O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2
Build a molecule that meets the requirement: It belongs to the 5ht2c receptor agonist class of molecules.	O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2
Can you create a molecule that matches the given characteristics? The molecule is a 5ht2c receptor agonist.	O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2
The molecule is a proton trap for oxidative phosphorylation and apoptosis, and it impacts non-alcoholic fatty liver disease. It impacts diabetic heart disease, tangier disease, and aging. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. Use the above information to create a molecule.	CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC
I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts non-alcoholic fatty liver disease. Please represent the molecule in SMILES.	CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both barth syndrome and diabetic heart disease. The molecule is both a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation.	CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease.	CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC
I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease. The molecule is a cholesterol translocation that impacts barth syndrome, aging, diabetic heart disease, and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.	CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC
Could you please return a molecule that adheres to this description? The molecule is both a hiv inhibitor and a anti viral.	CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a hiv inhibitor and is anti viral.	CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2
Come up with a molecule based on the description: The molecule is both a hiv inhibitor and a anti viral.	CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2
Generate a molecule that fulfills the requirement: The molecule is a hiv inhibitor and is anti viral.	CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2
Can you create a molecule that matches the given characteristics? The molecule is a hiv inhibitor and is anti viral.	CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2
I need a molecule that meets the following conditions: The molecule is a anti inflammatory. Please represent the molecule in SMILES.	COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a anti inflammatory.	COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a anti inflammatory.	COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2
Come up with a molecule based on the description: The molecule is anti inflammatory.	COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2
The molecule is anti inflammatory. Use the above information to create a molecule.	COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2
Build a molecule that meets the requirement: The molecule is a hcv inhibitor and a anti viral, belonging to the anti viral compound class of molecules. The molecule is a ns5a inhibitor.	CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a hcv inhibitor and is anti viral compound. The molecule is a ns5a inhibitor and is anti viral.	CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1
I need a molecule that meets the following conditions: The molecule is a hcv inhibitor and ns5a inhibitor, belonging to the anti viral class of molecules, and is anti viral compound. Please represent the molecule in SMILES.	CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1
Suppose there is a molecule that meets the following description: The molecule is a hcv inhibitor and ns5a inhibitor, belonging to both the anti viral and anti viral compound classes of molecules. Please write the SMILES representation of it.	CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1
Can you create a molecule that matches the given characteristics? The molecule is a ns5a inhibitor and is anti viral compound. The molecule is both a anti viral and a hcv inhibitor.	CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1
Could you please return a molecule that adheres to this description? The molecule is a light-emitting device and belongs to the light-emitting class of molecules.	CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1
Can you create a molecule that matches the given characteristics? The molecule is a light-emitting device and belongs to the light-emitting class of molecules.	CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1
Conceptualize a molecule that meets the specified attribute(s): This molecule is a member of the light-emitting class and influences light-emitting device.	CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1
The molecule is a light-emitting device and belongs to the light-emitting class of molecules. Use the above information to create a molecule.	CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a light-emitting device and belongs to the light-emitting class of molecules.	CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure and apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and stabilizing cytochrome oxidase, and it impacts aging. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, and diabetic heart disease.	CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC
Can you create a molecule that matches the given characteristics? It impacts tangier disease. The molecule is a cholesterol translocation, a apoptosis, and a stabilizing cytochrome oxidase, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and aging.	CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC
Could you please return a molecule that adheres to this description? The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a cholesterol translocation, and a apoptosis, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.	CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC
Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation. The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease.	CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC
Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure that impacts both barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase that impacts both diabetic heart disease and tangier disease. The molecule is a cholesterol translocation, a apoptosis, and a proton trap for oxidative phosphorylation, and it impacts aging.	CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC
The molecule is a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both aging and barth syndrome. The molecule is both a apoptosis and a stabilizing mitochondrial structure. Use the above information to create a molecule.	CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC
Could you please return a molecule that adheres to this description? The molecule is a apoptosis that impacts both aging and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a stabilizing mitochondrial structure.	CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC
Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, aging, and tangier disease.	CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a apoptosis, and it impacts non-alcoholic fatty liver disease.	CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC
The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging and diabetic heart disease. Use the above information to create a molecule.	CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC
Generate a molecule based on this description: The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, aging, diabetic heart disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease.	CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both aging and barth syndrome.	CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, and aging.	CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and tangier disease. The molecule is a cholesterol translocation and a apoptosis, impacting both non-alcoholic fatty liver disease and diabetic heart disease.	CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation and a apoptosis, impacting both barth syndrome and tangier disease.	CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Generate a molecule based on this description: The molecule is a nutrient that impacts both atherosclerosis and pancreatitis. The molecule is a fat storage and thyroxine treatment, impacting both metabolic syndrome and cardiovascular disease.	CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC
I need a molecule that meets the following conditions: The molecule is a nutrient and fat storage, and it impacts metabolic syndrome. The molecule is thyroxine treatment and impacts pancreatitis, cardiovascular disease, and atherosclerosis. Please represent the molecule in SMILES.	CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC
I need a molecule that meets the following conditions: The molecule is a member of the thyroxine treatment class and affects pancreatitis, atherosclerosis, and cardiovascular disease. The molecule is a nutrient and fat storage, and it impacts metabolic syndrome. Please represent the molecule in SMILES.	CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC
Generate a molecule that fulfills the requirement: The molecule is a nutrient and thyroxine treatment, impacting both metabolic syndrome and pancreatitis. The molecule is a fat storage that impacts both atherosclerosis and cardiovascular disease.	CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC
It impacts atherosclerosis, cardiovascular disease, thyroxine treatment, and metabolic syndrome. The molecule is a fat storage and nutrient, and it impacts pancreatitis. Use the above information to create a molecule.	CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC
I need a molecule that meets the following conditions: It impacts diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging. Please represent the molecule in SMILES.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Generate a molecule based on this description: The molecule is a apoptosis and a stabilizing mitochondrial structure, impacting both diabetic heart disease and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging. It impacts non-alcoholic fatty liver disease.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
I need a molecule that meets the following conditions: The molecule is a apoptosis that impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both aging and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation that impacts tangier disease, aging, and barth syndrome. Use the above information to create a molecule.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging and non-alcoholic fatty liver disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease. Please write the SMILES representation of it.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Can you create a molecule that matches the given characteristics? The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, alzheimer's disease, and non-alcoholic fatty liver disease.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN
Build a molecule that meets the requirement: It impacts both alzheimer's disease and parkinson's disease. The molecule is a nutrient that impacts both diabetes mellitus type 2 and non-alcoholic fatty liver disease.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN
The molecule is a nutrient that impacts alzheimer's disease, diabetes mellitus type 2, and parkinson's disease. It impacts non-alcoholic fatty liver disease. Use the above information to create a molecule.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN
Give me a molecule that satisfies the conditions outlined in the description: It impacts parkinson's disease, non-alcoholic fatty liver disease, and alzheimer's disease. The molecule is a nutrient that impacts diabetes mellitus type 2.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN
Can you create a molecule that matches the given characteristics? The molecule is a nutrient that impacts diabetes mellitus type 2, alzheimer's disease, non-alcoholic fatty liver disease, and parkinson's disease.	CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging, tangier disease, and barth syndrome. The molecule is a cholesterol translocation and a apoptosis, impacting both non-alcoholic fatty liver disease and diabetic heart disease.	CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase that impacts aging, tangier disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease.	CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation that impacts both diabetic heart disease and aging. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a apoptosis.	CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease. It impacts diabetic heart disease, aging, non-alcoholic fatty liver disease, and barth syndrome.	CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC
The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. Use the above information to create a molecule.	CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC
Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts diabetes mellitus type 2. It impacts parkinson's disease, alzheimer's disease, and non-alcoholic fatty liver disease.	CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN
Based on the given information, generate a molecule that meets the desired specifications: It impacts diabetes mellitus type 2, parkinson's disease, and alzheimer's disease. The molecule is a nutrient that impacts non-alcoholic fatty liver disease.	CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN
I need a molecule that meets the following conditions: The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, and alzheimer's disease. It impacts non-alcoholic fatty liver disease. Please represent the molecule in SMILES.	CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN
I need a molecule that meets the following conditions: The molecule is a nutrient that impacts diabetes mellitus type 2, parkinson's disease, non-alcoholic fatty liver disease, and alzheimer's disease. Please represent the molecule in SMILES.	CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, parkinson's disease, and alzheimer's disease.	CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN
Could you please return a molecule that adheres to this description? It impacts barth syndrome, diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts aging. The molecule is both a apoptosis and a stabilizing cytochrome oxidase.	CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC
Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both barth syndrome and diabetic heart disease. The molecule is both a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure.	CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC
Build a molecule that meets the requirement: The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a cholesterol translocation. The molecule is a stabilizing mitochondrial structure that impacts both tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and diabetic heart disease.	CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC
Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and cholesterol translocation, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts both aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and non-alcoholic fatty liver disease.	CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation that impacts tangier disease, aging, and diabetic heart disease.	CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC
Could you please return a molecule that adheres to this description? The molecule is a optoelectronic and belongs to the liquid crystal class of molecules.	CCCCCc1ccc2cc(-c3ccc(-c4cc(F)c(OC)c(F)c4)c(F)c3)ccc2c1
Build a molecule that meets the requirement: The molecule is both a liquid crystal and a optoelectronic.	CCCCCc1ccc2cc(-c3ccc(-c4cc(F)c(OC)c(F)c4)c(F)c3)ccc2c1
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a liquid crystal and is optoelectronic.	CCCCCc1ccc2cc(-c3ccc(-c4cc(F)c(OC)c(F)c4)c(F)c3)ccc2c1
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a liquid crystal and belongs to the optoelectronic class of molecules.	CCCCCc1ccc2cc(-c3ccc(-c4cc(F)c(OC)c(F)c4)c(F)c3)ccc2c1
I need a molecule that meets the following conditions: The molecule is a liquid crystal and is optoelectronic. Please represent the molecule in SMILES.	CCCCCc1ccc2cc(-c3ccc(-c4cc(F)c(OC)c(F)c4)c(F)c3)ccc2c1

Can you create a molecule that matches the given characteristics? The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease.

CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC

Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation that impacts both tangier disease and diabetic heart disease. The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a apoptosis.

CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC

Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and barth syndrome.

CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC

Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation that impacts both barth syndrome and tangier disease. The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure. The molecule is a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease.

CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation, stabilizing cytochrome oxidase. It impacts barth syndrome, tangier disease, non-alcoholic fatty liver disease, and aging.

CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. The molecule is both a apoptosis and a cholesterol translocation.

CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C

Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging.

CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C

Generate a molecule based on this description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and tangier disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.

CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C

Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation, impacting both tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome. Please write the SMILES representation of it.

CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C

Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and barth syndrome. The molecule is a apoptosis and a cholesterol translocation, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure that impacts aging.

CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C

Can you create a molecule that matches the given characteristics? It impacts both cardiovascular disease and pancreatitis. The molecule is a nutrient, fat storage, thyroxine treatment that impacts metabolic syndrome and atherosclerosis.

CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Generate a molecule that fulfills the requirement: The molecule is a fat storage that impacts pancreatitis. The molecule is a nutrient that impacts atherosclerosis, cardiovascular disease, metabolic syndrome, and thyroxine treatment.

CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Come up with a molecule based on the description: It impacts pancreatitis. The molecule is a nutrient and a fat storage, which impacts cardiovascular disease, metabolic syndrome, and atherosclerosis, and is characterized as thyroxine treatment.

CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Build a molecule that meets the requirement: The molecule is a nutrient and thyroxine treatment, impacting pancreatitis, metabolic syndrome, and atherosclerosis. The molecule is a fat storage that impacts cardiovascular disease.

CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Based on the given information, generate a molecule that meets the desired specifications: The molecule is a fat storage, nutrient, thyroxine treatment that impacts metabolic syndrome and cardiovascular disease. It impacts both pancreatitis and atherosclerosis.

CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Come up with a molecule based on the description: The molecule is a anti protozoal and is anti bacterial.

CC(C)(C)C(N)c1nc2ccccc2[nH]1

Can you create a molecule that matches the given characteristics? The molecule is a anti protozoal and is anti bacterial.

CC(C)(C)C(N)c1nc2ccccc2[nH]1

Build a molecule that meets the requirement: It belongs to both the anti protozoal and anti bacterial classes of molecules.

CC(C)(C)C(N)c1nc2ccccc2[nH]1

The molecule is a anti protozoal member of the anti bacterial class. Use the above information to create a molecule.

CC(C)(C)C(N)c1nc2ccccc2[nH]1

Suppose there is a molecule that meets the following description: The molecule is a anti protozoal member of the anti bacterial class. Please write the SMILES representation of it.

CC(C)(C)C(N)c1nc2ccccc2[nH]1

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a 5ht2c receptor agonist.

O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2

The molecule is a 5ht2c receptor agonist. Use the above information to create a molecule.

O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2

Give me a molecule that satisfies the conditions outlined in the description: The molecule is a 5ht2c receptor agonist.

O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2

Build a molecule that meets the requirement: It belongs to the 5ht2c receptor agonist class of molecules.

O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2

Can you create a molecule that matches the given characteristics? The molecule is a 5ht2c receptor agonist.

O=C(Nc1cccnc1)c1ccc2c3c1CCN3CCNC2

The molecule is a proton trap for oxidative phosphorylation and apoptosis, and it impacts non-alcoholic fatty liver disease. It impacts diabetic heart disease, tangier disease, and aging. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. Use the above information to create a molecule.

CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC

I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, tangier disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts non-alcoholic fatty liver disease. Please represent the molecule in SMILES.

CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC

Can you create a molecule that matches the given characteristics? The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, tangier disease, and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both barth syndrome and diabetic heart disease. The molecule is both a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation.

CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC

Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease.

CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC

I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts tangier disease. The molecule is a cholesterol translocation that impacts barth syndrome, aging, diabetic heart disease, and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.

CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC

Could you please return a molecule that adheres to this description? The molecule is both a hiv inhibitor and a anti viral.

CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2

Based on the given information, generate a molecule that meets the desired specifications: The molecule is a hiv inhibitor and is anti viral.

CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2

Come up with a molecule based on the description: The molecule is both a hiv inhibitor and a anti viral.

CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2

Generate a molecule that fulfills the requirement: The molecule is a hiv inhibitor and is anti viral.

CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2

Can you create a molecule that matches the given characteristics? The molecule is a hiv inhibitor and is anti viral.

CCOC(=O)C(OC(C)(C)C)c1c(C)c2c(c(C)c1-c1cc(F)c3c(c1C)CCCO3)CCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CC2

I need a molecule that meets the following conditions: The molecule is a anti inflammatory. Please represent the molecule in SMILES.

COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2

Give me a molecule that satisfies the conditions outlined in the description: The molecule is a anti inflammatory.

COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2

Based on the given information, generate a molecule that meets the desired specifications: The molecule is a anti inflammatory.

COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2

Come up with a molecule based on the description: The molecule is anti inflammatory.

COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2

The molecule is anti inflammatory. Use the above information to create a molecule.

COc1ccc2c(c1)Sc1cccc(C(=O)O)c1N2

Build a molecule that meets the requirement: The molecule is a hcv inhibitor and a anti viral, belonging to the anti viral compound class of molecules. The molecule is a ns5a inhibitor.

CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a hcv inhibitor and is anti viral compound. The molecule is a ns5a inhibitor and is anti viral.

CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1

I need a molecule that meets the following conditions: The molecule is a hcv inhibitor and ns5a inhibitor, belonging to the anti viral class of molecules, and is anti viral compound. Please represent the molecule in SMILES.

CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1

Suppose there is a molecule that meets the following description: The molecule is a hcv inhibitor and ns5a inhibitor, belonging to both the anti viral and anti viral compound classes of molecules. Please write the SMILES representation of it.

CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1

Can you create a molecule that matches the given characteristics? The molecule is a ns5a inhibitor and is anti viral compound. The molecule is both a anti viral and a hcv inhibitor.

CCCNCc1nc2ccc(C#Cc3ccc(-c4cnc(CN(CCC)C(=O)OC(C)(C)C)[nH]4)cc3)cc2[nH]1

Could you please return a molecule that adheres to this description? The molecule is a light-emitting device and belongs to the light-emitting class of molecules.

CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1

Can you create a molecule that matches the given characteristics? The molecule is a light-emitting device and belongs to the light-emitting class of molecules.

CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1

Conceptualize a molecule that meets the specified attribute(s): This molecule is a member of the light-emitting class and influences light-emitting device.

CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1

The molecule is a light-emitting device and belongs to the light-emitting class of molecules. Use the above information to create a molecule.

CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1

Give me a molecule that satisfies the conditions outlined in the description: The molecule is a light-emitting device and belongs to the light-emitting class of molecules.

CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3cc(-c4cc(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4)cc(N4c5ccc(Cl)cc5Oc5cc(Cl)ccc54)c3)c2)cc1

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure and apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and stabilizing cytochrome oxidase, and it impacts aging. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, and diabetic heart disease.

CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC

Can you create a molecule that matches the given characteristics? It impacts tangier disease. The molecule is a cholesterol translocation, a apoptosis, and a stabilizing cytochrome oxidase, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and aging.

CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC

Could you please return a molecule that adheres to this description? The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a cholesterol translocation, and a apoptosis, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.

CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC

Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation. The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease.

CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC

Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure that impacts both barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase that impacts both diabetic heart disease and tangier disease. The molecule is a cholesterol translocation, a apoptosis, and a proton trap for oxidative phosphorylation, and it impacts aging.

CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC

The molecule is a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both aging and barth syndrome. The molecule is both a apoptosis and a stabilizing mitochondrial structure. Use the above information to create a molecule.

CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC

Could you please return a molecule that adheres to this description? The molecule is a apoptosis that impacts both aging and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a stabilizing mitochondrial structure.

CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC

Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, aging, and tangier disease.

CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a apoptosis, and it impacts non-alcoholic fatty liver disease.

CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC

The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging and diabetic heart disease. Use the above information to create a molecule.

CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC

Generate a molecule based on this description: The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, aging, diabetic heart disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease.

CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both aging and barth syndrome.

CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, and aging.

CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and tangier disease. The molecule is a cholesterol translocation and a apoptosis, impacting both non-alcoholic fatty liver disease and diabetic heart disease.

CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation and a apoptosis, impacting both barth syndrome and tangier disease.

CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC

Generate a molecule based on this description: The molecule is a nutrient that impacts both atherosclerosis and pancreatitis. The molecule is a fat storage and thyroxine treatment, impacting both metabolic syndrome and cardiovascular disease.

CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC

I need a molecule that meets the following conditions: The molecule is a nutrient and fat storage, and it impacts metabolic syndrome. The molecule is thyroxine treatment and impacts pancreatitis, cardiovascular disease, and atherosclerosis. Please represent the molecule in SMILES.

CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC

I need a molecule that meets the following conditions: The molecule is a member of the thyroxine treatment class and affects pancreatitis, atherosclerosis, and cardiovascular disease. The molecule is a nutrient and fat storage, and it impacts metabolic syndrome. Please represent the molecule in SMILES.

CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC

Generate a molecule that fulfills the requirement: The molecule is a nutrient and thyroxine treatment, impacting both metabolic syndrome and pancreatitis. The molecule is a fat storage that impacts both atherosclerosis and cardiovascular disease.

CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC

It impacts atherosclerosis, cardiovascular disease, thyroxine treatment, and metabolic syndrome. The molecule is a fat storage and nutrient, and it impacts pancreatitis. Use the above information to create a molecule.

CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC

I need a molecule that meets the following conditions: It impacts diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging. Please represent the molecule in SMILES.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C

Generate a molecule based on this description: The molecule is a apoptosis and a stabilizing mitochondrial structure, impacting both diabetic heart disease and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging. It impacts non-alcoholic fatty liver disease.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C

I need a molecule that meets the following conditions: The molecule is a apoptosis that impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both aging and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C

The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation that impacts tangier disease, aging, and barth syndrome. Use the above information to create a molecule.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C

Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging and non-alcoholic fatty liver disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease. Please write the SMILES representation of it.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C

Can you create a molecule that matches the given characteristics? The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, alzheimer's disease, and non-alcoholic fatty liver disease.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN

Build a molecule that meets the requirement: It impacts both alzheimer's disease and parkinson's disease. The molecule is a nutrient that impacts both diabetes mellitus type 2 and non-alcoholic fatty liver disease.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN

The molecule is a nutrient that impacts alzheimer's disease, diabetes mellitus type 2, and parkinson's disease. It impacts non-alcoholic fatty liver disease. Use the above information to create a molecule.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN

Give me a molecule that satisfies the conditions outlined in the description: It impacts parkinson's disease, non-alcoholic fatty liver disease, and alzheimer's disease. The molecule is a nutrient that impacts diabetes mellitus type 2.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN

Can you create a molecule that matches the given characteristics? The molecule is a nutrient that impacts diabetes mellitus type 2, alzheimer's disease, non-alcoholic fatty liver disease, and parkinson's disease.

CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC)COP(=O)(O)OCCN

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging, tangier disease, and barth syndrome. The molecule is a cholesterol translocation and a apoptosis, impacting both non-alcoholic fatty liver disease and diabetic heart disease.

CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC

Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase that impacts aging, tangier disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease.

CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC

Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation that impacts both diabetic heart disease and aging. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a apoptosis.

CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC

Can you create a molecule that matches the given characteristics? The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease. It impacts diabetic heart disease, aging, non-alcoholic fatty liver disease, and barth syndrome.

CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC

The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. Use the above information to create a molecule.

CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC

Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts diabetes mellitus type 2. It impacts parkinson's disease, alzheimer's disease, and non-alcoholic fatty liver disease.

CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN

Based on the given information, generate a molecule that meets the desired specifications: It impacts diabetes mellitus type 2, parkinson's disease, and alzheimer's disease. The molecule is a nutrient that impacts non-alcoholic fatty liver disease.

CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN

I need a molecule that meets the following conditions: The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, and alzheimer's disease. It impacts non-alcoholic fatty liver disease. Please represent the molecule in SMILES.

CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN

I need a molecule that meets the following conditions: The molecule is a nutrient that impacts diabetes mellitus type 2, parkinson's disease, non-alcoholic fatty liver disease, and alzheimer's disease. Please represent the molecule in SMILES.

CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, parkinson's disease, and alzheimer's disease.

CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN

Could you please return a molecule that adheres to this description? It impacts barth syndrome, diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a proton trap for oxidative phosphorylation, and it impacts aging. The molecule is both a apoptosis and a stabilizing cytochrome oxidase.

CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC

Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both barth syndrome and diabetic heart disease. The molecule is both a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure.

CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC

Build a molecule that meets the requirement: The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a cholesterol translocation. The molecule is a stabilizing mitochondrial structure that impacts both tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and diabetic heart disease.

CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC

Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and cholesterol translocation, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts both aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and non-alcoholic fatty liver disease.

CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC

I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation that impacts tangier disease, aging, and diabetic heart disease.

CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC

Could you please return a molecule that adheres to this description? The molecule is a optoelectronic and belongs to the liquid crystal class of molecules.